C24H27N3O — CID 42731413
(E)-N-[3-tert-butyl-1-(2,3-dimethylphenyl)pyrazol-5-yl]-3-phenylprop-2-enamide (PubChem CID 42731413) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is (E)-N-[3-tert-butyl-1-(2,3-dimethylphenyl)pyrazol-5-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-tert-butyl-1-(2,3-dimethylphenyl)pyrazol-5-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42731413 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | (E)-N-[3-tert-butyl-1-(2,3-dimethylphenyl)pyrazol-5-yl]-3-phenylprop-2-enamide |
| SMILES | Cc1cccc(-n2nc(C(C)(C)C)cc2NC(=O)/C=C/c2ccccc2)c1C |
| InChI | InChI=1S/C24H27N3O/c1-17-10-9-13-20(18(17)2)27-22(16-21(26-27)24(3,4)5)25-23(28)15-14-19-11-7-6-8-12-19/h6-16H,1-5H3,(H,25,28)/b15-14+ |
| InChIKey | JQIQZGKPDBJTDL-CCEZHUSRSA-N |
| XLogP | 5.44 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|