C20H19F2N3O2 — CID 66928924
N-[1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]pyrazol-4-yl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 66928924) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-[1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]pyrazol-4-yl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-[1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]pyrazol-4-yl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 66928924 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[1-[[5-(1,1-difluoroethyl)furan-2-yl]methyl]pyrazol-4-yl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)Nc2cnn(Cc3ccc(C(C)(F)F)o3)c2)cc1 |
| InChI | InChI=1S/C20H19F2N3O2/c1-14-3-5-15(6-4-14)7-10-19(26)24-16-11-23-25(12-16)13-17-8-9-18(27-17)20(2,21)22/h3-12H,13H2,1-2H3,(H,24,26) |
| InChIKey | FQHGOYMNRYFBLC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|