C19H15Cl2N3O3 — CID 66928566
(Z)-N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-4-yl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 66928566) has the molecular formula C19H15Cl2N3O3 and a molecular weight of 404.25 g/mol. Its IUPAC name is (Z)-N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-4-yl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-4-yl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 66928566 |
| Molecular Formula | C19H15Cl2N3O3 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | (Z)-N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-4-yl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | CC(=O)c1ccc(Cn2cc(NC(=O)/C=C\c3ccc(Cl)cc3Cl)cn2)o1 |
| InChI | InChI=1S/C19H15Cl2N3O3/c1-12(25)18-6-5-16(27-18)11-24-10-15(9-22-24)23-19(26)7-3-13-2-4-14(20)8-17(13)21/h2-10H,11H2,1H3,(H,23,26)/b7-3- |
| InChIKey | RYTZEHUZCKEPJF-CLTKARDFSA-N |
| XLogP | 4.69 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|