C19H15ClFN3O3 — CID 66928421
(Z)-N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-3-yl]-3-(2-chloro-4-fluorophenyl)prop-2-enamide (PubChem CID 66928421) has the molecular formula C19H15ClFN3O3 and a molecular weight of 387.80 g/mol. Its IUPAC name is (Z)-N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-3-yl]-3-(2-chloro-4-fluorophenyl)prop-2-enamide.
| Compound Name | (Z)-N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-3-yl]-3-(2-chloro-4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 66928421 |
| Molecular Formula | C19H15ClFN3O3 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (Z)-N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-3-yl]-3-(2-chloro-4-fluorophenyl)prop-2-enamide |
| SMILES | CC(=O)c1ccc(Cn2ccc(NC(=O)/C=C\c3ccc(F)cc3Cl)n2)o1 |
| InChI | InChI=1S/C19H15ClFN3O3/c1-12(25)17-6-5-15(27-17)11-24-9-8-18(23-24)22-19(26)7-3-13-2-4-14(21)10-16(13)20/h2-10H,11H2,1H3,(H,22,23,26)/b7-3- |
| InChIKey | OOEFMGWAWARVHE-CLTKARDFSA-N |
| XLogP | 4.17 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|