C18H15ClFN3O4 — CID 42647025
(2-chloro-4-fluorophenyl)methyl N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-3-yl]carbamate (PubChem CID 42647025) has the molecular formula C18H15ClFN3O4 and a molecular weight of 391.79 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)methyl N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-3-yl]carbamate.
| Compound Name | (2-chloro-4-fluorophenyl)methyl N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-3-yl]carbamate |
|---|---|
| PubChem CID | 42647025 |
| Molecular Formula | C18H15ClFN3O4 |
| Molecular Weight | 391.79 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | (2-chloro-4-fluorophenyl)methyl N-[1-[(5-acetylfuran-2-yl)methyl]pyrazol-3-yl]carbamate |
| SMILES | CC(=O)c1ccc(Cn2ccc(NC(=O)OCc3ccc(F)cc3Cl)n2)o1 |
| InChI | InChI=1S/C18H15ClFN3O4/c1-11(24)16-5-4-14(27-16)9-23-7-6-17(22-23)21-18(25)26-10-12-2-3-13(20)8-15(12)19/h2-8H,9-10H2,1H3,(H,21,22,25) |
| InChIKey | KTRVGWKEVNMBHE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.79 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |