C18H19ClFN3O2 — CID 66929528
(E)-3-(2-chloro-6-fluorophenyl)-N-[1-(5-oxohexyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 66929528) has the molecular formula C18H19ClFN3O2 and a molecular weight of 363.82 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-[1-(5-oxohexyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[1-(5-oxohexyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 66929528 |
| Molecular Formula | C18H19ClFN3O2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[1-(5-oxohexyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | CC(=O)CCCCn1cc(NC(=O)/C=C/c2c(F)cccc2Cl)cn1 |
| InChI | InChI=1S/C18H19ClFN3O2/c1-13(24)5-2-3-10-23-12-14(11-21-23)22-18(25)9-8-15-16(19)6-4-7-17(15)20/h4,6-9,11-12H,2-3,5,10H2,1H3,(H,22,25)/b9-8+ |
| InChIKey | LLXYXQBLZPDFSR-CMDGGOBGSA-N |
| XLogP | 4.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|