C22H27ClN4O4Si — CID 66928977
CID 66928977 (PubChem CID 66928977) has the molecular formula C22H27ClN4O4Si and a molecular weight of 475.02 g/mol.
| Compound Name | CID 66928977 |
|---|---|
| PubChem CID | 66928977 |
| Molecular Formula | C22H27ClN4O4Si |
| Molecular Weight | 475.02 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1nc(Cn2cc(NC(=O)OCc3ccccc3Cl)cn2)co1 |
| InChI | InChI=1S/C22H27ClN4O4Si/c1-21(2,3)32-31-22(4,5)19-25-17(14-29-19)12-27-11-16(10-24-27)26-20(28)30-13-15-8-6-7-9-18(15)23/h6-11,14H,12-13H2,1-5H3,(H,26,28) |
| InChIKey | FXOMSVIIPYHHGU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.02 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|