C21H25F2N3O3S — CID 34193952
4-(difluoromethylsulfonyl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]benzamide (PubChem CID 34193952) has the molecular formula C21H25F2N3O3S and a molecular weight of 437.51 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 34193952 |
| Molecular Formula | C21H25F2N3O3S |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]benzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc(S(=O)(=O)C(F)F)cc3)c(C)c2)CC1 |
| InChI | InChI=1S/C21H25F2N3O3S/c1-3-25-10-12-26(13-11-25)17-6-9-19(15(2)14-17)24-20(27)16-4-7-18(8-5-16)30(28,29)21(22)23/h4-9,14,21H,3,10-13H2,1-2H3,(H,24,27) |
| InChIKey | DZNUYRBGXDTAHE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|