C23H29ClN4O3S — CID 35893373
4-chloro-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 35893373) has the molecular formula C23H29ClN4O3S and a molecular weight of 477.03 g/mol. Its IUPAC name is 4-chloro-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 35893373 |
| Molecular Formula | C23H29ClN4O3S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 4-chloro-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)Nc2ccc(N3CCN(CC)CC3)cc2C)ccc1Cl |
| InChI | InChI=1S/C23H29ClN4O3S/c1-4-10-25-32(30,31)22-16-18(6-8-20(22)24)23(29)26-21-9-7-19(15-17(21)3)28-13-11-27(5-2)12-14-28/h4,6-9,15-16,25H,1,5,10-14H2,2-3H3,(H,26,29) |
| InChIKey | KBTCTKUFPKUNEE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|