3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid

C16H16N2O3 — CID 63117351

IUPAC3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid
SMILESCc1ccc(C(=O)Nc2ccc(C(=O)O)cc2N)cc1C
InChIInChI=1S/C16H16N2O3/c1-9-3-4-11(7-10(9)2)15(19)18-14-6-5-12(16(20)21)8-13(14)17/h3-8H,17H2,1-2H3,(H,18,19)(H,20,21)
InChIKeyUJFPZZPQHXHFEC-UHFFFAOYSA-N
MW284.32 g/mol
LogP2.84
Rot. Bonds3

About 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid

3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid (PubChem CID 63117351) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid
PubChem CID63117351
Molecular FormulaC16H16N2O3
Molecular Weight284.32 g/mol
Exact Mass284.12
IUPAC Name3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid
SMILESCc1ccc(C(=O)Nc2ccc(C(=O)O)cc2N)cc1C
InChIInChI=1S/C16H16N2O3/c1-9-3-4-11(7-10(9)2)15(19)18-14-6-5-12(16(20)21)8-13(14)17/h3-8H,17H2,1-2H3,(H,18,19)(H,20,21)
InChIKeyUJFPZZPQHXHFEC-UHFFFAOYSA-N
XLogP2.84
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.32
LogP ≤ 52.84
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid?
The IUPAC name of 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid (CID 63117351) is 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid.
What is the SMILES notation for 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid?
The canonical SMILES for 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid is Cc1ccc(C(=O)Nc2ccc(C(=O)O)cc2N)cc1C.
What is the InChIKey of 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid?
The InChIKey is UJFPZZPQHXHFEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-9-3-4-11(7-10(9)2)15(19)18-14-6-5-12(16(20)21)8-13(14)17/h3-8H,17H2,1-2H3,(H,18,19)(H,20,21).
What are the key properties of 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid?
3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid has a molecular weight of 284.32 g/mol, XLogP of 2.84, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[(3,4-dimethylbenzoyl)amino]benzoic acid is sourced from PubChem (CID 63117351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).