C21H20N4O3 — CID 124697850
(3R)-1-[5-methyl-1-(4-phenylphenyl)triazole-4-carbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 124697850) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is (3R)-1-[5-methyl-1-(4-phenylphenyl)triazole-4-carbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[5-methyl-1-(4-phenylphenyl)triazole-4-carbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124697850 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (3R)-1-[5-methyl-1-(4-phenylphenyl)triazole-4-carbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | Cc1c(C(=O)N2CC[C@@H](C(=O)O)C2)nnn1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N4O3/c1-14-19(20(26)24-12-11-17(13-24)21(27)28)22-23-25(14)18-9-7-16(8-10-18)15-5-3-2-4-6-15/h2-10,17H,11-13H2,1H3,(H,27,28)/t17-/m1/s1 |
| InChIKey | DOFNWMMRFBYXGI-QGZVFWFLSA-N |
| XLogP | 2.79 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |