C21H20N4O4 — CID 125152338
(3R)-4-[5-methyl-1-(4-phenylphenyl)triazole-4-carbonyl]morpholine-3-carboxylic acid (PubChem CID 125152338) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is (3R)-4-[5-methyl-1-(4-phenylphenyl)triazole-4-carbonyl]morpholine-3-carboxylic acid.
| Compound Name | (3R)-4-[5-methyl-1-(4-phenylphenyl)triazole-4-carbonyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 125152338 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (3R)-4-[5-methyl-1-(4-phenylphenyl)triazole-4-carbonyl]morpholine-3-carboxylic acid |
| SMILES | Cc1c(C(=O)N2CCOC[C@@H]2C(=O)O)nnn1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N4O4/c1-14-19(20(26)24-11-12-29-13-18(24)21(27)28)22-23-25(14)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-10,18H,11-13H2,1H3,(H,27,28)/t18-/m1/s1 |
| InChIKey | OCGRLOQDODVFGW-GOSISDBHSA-N |
| XLogP | 2.17 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |