C16H21N5O — CID 124574837
[(3S)-3-(methylamino)piperidin-1-yl]-[1-(4-methylphenyl)triazol-4-yl]methanone (PubChem CID 124574837) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is [(3S)-3-(methylamino)piperidin-1-yl]-[1-(4-methylphenyl)triazol-4-yl]methanone.
| Compound Name | [(3S)-3-(methylamino)piperidin-1-yl]-[1-(4-methylphenyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 124574837 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | [(3S)-3-(methylamino)piperidin-1-yl]-[1-(4-methylphenyl)triazol-4-yl]methanone |
| SMILES | CN[C@H]1CCCN(C(=O)c2cn(-c3ccc(C)cc3)nn2)C1 |
| InChI | InChI=1S/C16H21N5O/c1-12-5-7-14(8-6-12)21-11-15(18-19-21)16(22)20-9-3-4-13(10-20)17-2/h5-8,11,13,17H,3-4,9-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | CUYGRTDECRNCCA-ZDUSSCGKSA-N |
| XLogP | 1.40 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |