C17H21N5O3S — CID 74232162
(2-anilinopyrimidin-5-yl)-(4-methylsulfonyl-1,4-diazepan-1-yl)methanone (PubChem CID 74232162) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is (2-anilinopyrimidin-5-yl)-(4-methylsulfonyl-1,4-diazepan-1-yl)methanone.
| Compound Name | (2-anilinopyrimidin-5-yl)-(4-methylsulfonyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 74232162 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (2-anilinopyrimidin-5-yl)-(4-methylsulfonyl-1,4-diazepan-1-yl)methanone |
| SMILES | CS(=O)(=O)N1CCCN(C(=O)c2cnc(Nc3ccccc3)nc2)CC1 |
| InChI | InChI=1S/C17H21N5O3S/c1-26(24,25)22-9-5-8-21(10-11-22)16(23)14-12-18-17(19-13-14)20-15-6-3-2-4-7-15/h2-4,6-7,12-13H,5,8-11H2,1H3,(H,18,19,20) |
| InChIKey | UHWXDSOIJFLOOE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |