C17H18N4O3 — CID 109249344
methyl 3-[[5-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]amino]benzoate (PubChem CID 109249344) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is methyl 3-[[5-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]amino]benzoate.
| Compound Name | methyl 3-[[5-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 109249344 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | methyl 3-[[5-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2ncc(C(=O)N3CCCC3)cn2)c1 |
| InChI | InChI=1S/C17H18N4O3/c1-24-16(23)12-5-4-6-14(9-12)20-17-18-10-13(11-19-17)15(22)21-7-2-3-8-21/h4-6,9-11H,2-3,7-8H2,1H3,(H,18,19,20) |
| InChIKey | MXOAVCPQVAIBQK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |