C16H19N5O3S — CID 74240836
(2-anilinopyrimidin-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 74240836) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is (2-anilinopyrimidin-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (2-anilinopyrimidin-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 74240836 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (2-anilinopyrimidin-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2cnc(Nc3ccccc3)nc2)CC1 |
| InChI | InChI=1S/C16H19N5O3S/c1-25(23,24)21-9-7-20(8-10-21)15(22)13-11-17-16(18-12-13)19-14-5-3-2-4-6-14/h2-6,11-12H,7-10H2,1H3,(H,17,18,19) |
| InChIKey | DMNYEIKFPRFRMR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |