C16H20N4O4S — CID 56907464
methyl 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1H-pyrazole-5-carboxylate (PubChem CID 56907464) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is methyl 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1H-pyrazole-5-carboxylate.
| Compound Name | methyl 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 56907464 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | methyl 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1H-pyrazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]ncc1CN1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H20N4O4S/c1-24-16(21)15-13(11-17-18-15)12-19-7-9-20(10-8-19)25(22,23)14-5-3-2-4-6-14/h2-6,11H,7-10,12H2,1H3,(H,17,18) |
| InChIKey | UBMSSCVJEDOWSK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |