C25H28N4O4S — CID 140702150
2-[(2S)-3-(hydroxyamino)-3-oxo-2-thiomorpholin-4-ylpropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 140702150) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-[(2S)-3-(hydroxyamino)-3-oxo-2-thiomorpholin-4-ylpropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | 2-[(2S)-3-(hydroxyamino)-3-oxo-2-thiomorpholin-4-ylpropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 140702150 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-[(2S)-3-(hydroxyamino)-3-oxo-2-thiomorpholin-4-ylpropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | Cc1cc(COc2ccc(C(N)=O)c(C[C@@H](C(=O)NO)N3CCSCC3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C25H28N4O4S/c1-16-12-18(20-4-2-3-5-22(20)27-16)15-33-19-6-7-21(24(26)30)17(13-19)14-23(25(31)28-32)29-8-10-34-11-9-29/h2-7,12-13,23,32H,8-11,14-15H2,1H3,(H2,26,30)(H,28,31)/t23-/m0/s1 |
| InChIKey | CHABNNPBURIBJE-QHCPKHFHSA-N |
| XLogP | 2.69 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|