C21H26N4O4 — CID 140702146
2-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]-4-(pyridin-4-ylmethoxy)benzamide (PubChem CID 140702146) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]-4-(pyridin-4-ylmethoxy)benzamide.
| Compound Name | 2-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]-4-(pyridin-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 140702146 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-[(2S)-3-(hydroxyamino)-3-oxo-2-piperidin-1-ylpropyl]-4-(pyridin-4-ylmethoxy)benzamide |
| SMILES | NC(=O)c1ccc(OCc2ccncc2)cc1C[C@@H](C(=O)NO)N1CCCCC1 |
| InChI | InChI=1S/C21H26N4O4/c22-20(26)18-5-4-17(29-14-15-6-8-23-9-7-15)12-16(18)13-19(21(27)24-28)25-10-2-1-3-11-25/h4-9,12,19,28H,1-3,10-11,13-14H2,(H2,22,26)(H,24,27)/t19-/m0/s1 |
| InChIKey | NLWAGLIDIBZBKX-IBGZPJMESA-N |
| XLogP | 1.66 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|