C27H31N3O4 — CID 118559738
N-hydroxy-4-methyl-2-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2-oxopyrrolidin-1-yl]pentanamide (PubChem CID 118559738) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-hydroxy-4-methyl-2-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2-oxopyrrolidin-1-yl]pentanamide.
| Compound Name | N-hydroxy-4-methyl-2-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2-oxopyrrolidin-1-yl]pentanamide |
|---|---|
| PubChem CID | 118559738 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N-hydroxy-4-methyl-2-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2-oxopyrrolidin-1-yl]pentanamide |
| SMILES | Cc1cc(COc2ccc(C3CCN(C(CC(C)C)C(=O)NO)C3=O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C27H31N3O4/c1-17(2)14-25(26(31)29-33)30-13-12-23(27(30)32)19-8-10-21(11-9-19)34-16-20-15-18(3)28-24-7-5-4-6-22(20)24/h4-11,15,17,23,25,33H,12-14,16H2,1-3H3,(H,29,31) |
| InChIKey | ARCVQGNNSVFCFI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|