C33H36N4O4S — CID 11227054
2-[3-amino-3-[4-[[2-(4-methylsulfanylphenyl)quinolin-4-yl]methoxy]phenyl]-2-oxopyrrolidin-1-yl]-N-hydroxy-4-methylpentanamide (PubChem CID 11227054) has the molecular formula C33H36N4O4S and a molecular weight of 584.74 g/mol. Its IUPAC name is 2-[3-amino-3-[4-[[2-(4-methylsulfanylphenyl)quinolin-4-yl]methoxy]phenyl]-2-oxopyrrolidin-1-yl]-N-hydroxy-4-methylpentanamide.
| Compound Name | 2-[3-amino-3-[4-[[2-(4-methylsulfanylphenyl)quinolin-4-yl]methoxy]phenyl]-2-oxopyrrolidin-1-yl]-N-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 11227054 |
| Molecular Formula | C33H36N4O4S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | 2-[3-amino-3-[4-[[2-(4-methylsulfanylphenyl)quinolin-4-yl]methoxy]phenyl]-2-oxopyrrolidin-1-yl]-N-hydroxy-4-methylpentanamide |
| SMILES | CSc1ccc(-c2cc(COc3ccc(C4(N)CCN(C(CC(C)C)C(=O)NO)C4=O)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C33H36N4O4S/c1-21(2)18-30(31(38)36-40)37-17-16-33(34,32(37)39)24-10-12-25(13-11-24)41-20-23-19-29(22-8-14-26(42-3)15-9-22)35-28-7-5-4-6-27(23)28/h4-15,19,21,30,40H,16-18,20,34H2,1-3H3,(H,36,38) |
| InChIKey | HKKPQHRDYQHIEH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|