C30H30N2O5 — CID 20748815
methyl 4-(hydroxyamino)-2,3-dimethyl-4-oxo-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]butanoate (PubChem CID 20748815) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is methyl 4-(hydroxyamino)-2,3-dimethyl-4-oxo-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]butanoate.
| Compound Name | methyl 4-(hydroxyamino)-2,3-dimethyl-4-oxo-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 20748815 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | methyl 4-(hydroxyamino)-2,3-dimethyl-4-oxo-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]butanoate |
| SMILES | COC(=O)C(C)(Cc1ccc(OCc2cc(-c3ccccc3)nc3ccccc23)cc1)C(C)C(=O)NO |
| InChI | InChI=1S/C30H30N2O5/c1-20(28(33)32-35)30(2,29(34)36-3)18-21-13-15-24(16-14-21)37-19-23-17-27(22-9-5-4-6-10-22)31-26-12-8-7-11-25(23)26/h4-17,20,35H,18-19H2,1-3H3,(H,32,33) |
| InChIKey | UZQCLGGJNKOPRD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|