C31H32N2O4 — CID 142258935
ethyl formate;N-[1-[2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropyl]ethenyl]hydroxylamine (PubChem CID 142258935) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is ethyl formate;N-[1-[2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropyl]ethenyl]hydroxylamine.
| Compound Name | ethyl formate;N-[1-[2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropyl]ethenyl]hydroxylamine |
|---|---|
| PubChem CID | 142258935 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | ethyl formate;N-[1-[2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropyl]ethenyl]hydroxylamine |
| SMILES | C=C(NO)C1CC1Cc1ccc(OCc2cc(-c3ccccc3)nc3ccccc23)cc1.CCOC=O |
| InChI | InChI=1S/C28H26N2O2.C3H6O2/c1-19(30-31)26-16-22(26)15-20-11-13-24(14-12-20)32-18-23-17-28(21-7-3-2-4-8-21)29-27-10-6-5-9-25(23)27;1-2-5-3-4/h2-14,17,22,26,30-31H,1,15-16,18H2;3H,2H2,1H3 |
| InChIKey | IOPFNJYTKBENGS-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|