C32H30N4O5 — CID 59978420
cis-(1S,2R)-N-hydroxy-2-(3-oxopiperazine-1-carbonyl)-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxamide (PubChem CID 59978420) has the molecular formula C32H30N4O5 and a molecular weight of 550.62 g/mol. Its IUPAC name is cis-(1S,2R)-N-hydroxy-2-(3-oxopiperazine-1-carbonyl)-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-hydroxy-2-(3-oxopiperazine-1-carbonyl)-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59978420 |
| Molecular Formula | C32H30N4O5 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | cis-(1S,2R)-N-hydroxy-2-(3-oxopiperazine-1-carbonyl)-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxamide |
| SMILES | O=C1CN(C(=O)[C@@]2(Cc3ccc(OCc4cc(-c5ccccc5)nc5ccccc45)cc3)C[C@@H]2C(=O)NO)CCN1 |
| InChI | InChI=1S/C32H30N4O5/c37-29-19-36(15-14-33-29)31(39)32(18-26(32)30(38)35-40)17-21-10-12-24(13-11-21)41-20-23-16-28(22-6-2-1-3-7-22)34-27-9-5-4-8-25(23)27/h1-13,16,26,40H,14-15,17-20H2,(H,33,37)(H,35,38)/t26-,32+/m1/s1 |
| InChIKey | WDMLYLNCIGUNGS-DICHSLLOSA-N |
| XLogP | 3.49 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|