C28H23ClFN3O4 — CID 20748498
1-[[4-[[2-(4-chlorophenyl)quinolin-4-yl]methoxy]-3-fluorophenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide (PubChem CID 20748498) has the molecular formula C28H23ClFN3O4 and a molecular weight of 519.96 g/mol. Its IUPAC name is 1-[[4-[[2-(4-chlorophenyl)quinolin-4-yl]methoxy]-3-fluorophenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide.
| Compound Name | 1-[[4-[[2-(4-chlorophenyl)quinolin-4-yl]methoxy]-3-fluorophenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 20748498 |
| Molecular Formula | C28H23ClFN3O4 |
| Molecular Weight | 519.96 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 1-[[4-[[2-(4-chlorophenyl)quinolin-4-yl]methoxy]-3-fluorophenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
| SMILES | NC(=O)C1(Cc2ccc(OCc3cc(-c4ccc(Cl)cc4)nc4ccccc34)c(F)c2)CC1C(=O)NO |
| InChI | InChI=1S/C28H23ClFN3O4/c29-19-8-6-17(7-9-19)24-12-18(20-3-1-2-4-23(20)32-24)15-37-25-10-5-16(11-22(25)30)13-28(27(31)35)14-21(28)26(34)33-36/h1-12,21,36H,13-15H2,(H2,31,35)(H,33,34) |
| InChIKey | VYLBVKGQBPUSLH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.96 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|