C24H25FN4O4 — CID 20748502
1-[[4-[[2-(dimethylamino)quinolin-4-yl]methoxy]-3-fluorophenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide (PubChem CID 20748502) has the molecular formula C24H25FN4O4 and a molecular weight of 452.49 g/mol. Its IUPAC name is 1-[[4-[[2-(dimethylamino)quinolin-4-yl]methoxy]-3-fluorophenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide.
| Compound Name | 1-[[4-[[2-(dimethylamino)quinolin-4-yl]methoxy]-3-fluorophenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 20748502 |
| Molecular Formula | C24H25FN4O4 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1-[[4-[[2-(dimethylamino)quinolin-4-yl]methoxy]-3-fluorophenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
| SMILES | CN(C)c1cc(COc2ccc(CC3(C(N)=O)CC3C(=O)NO)cc2F)c2ccccc2n1 |
| InChI | InChI=1S/C24H25FN4O4/c1-29(2)21-10-15(16-5-3-4-6-19(16)27-21)13-33-20-8-7-14(9-18(20)25)11-24(23(26)31)12-17(24)22(30)28-32/h3-10,17,32H,11-13H2,1-2H3,(H2,26,31)(H,28,30) |
| InChIKey | UQQFQLYSMNKWLR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|