C26H26FN3O5 — CID 10310988
trans-methyl (1S,2S)-1-[3-fluoro-4-[(2-pyrrolidin-1-ylquinolin-4-yl)methoxy]phenyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate (PubChem CID 10310988) has the molecular formula C26H26FN3O5 and a molecular weight of 479.51 g/mol. Its IUPAC name is trans-methyl (1S,2S)-1-[3-fluoro-4-[(2-pyrrolidin-1-ylquinolin-4-yl)methoxy]phenyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-1-[3-fluoro-4-[(2-pyrrolidin-1-ylquinolin-4-yl)methoxy]phenyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 10310988 |
| Molecular Formula | C26H26FN3O5 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | trans-methyl (1S,2S)-1-[3-fluoro-4-[(2-pyrrolidin-1-ylquinolin-4-yl)methoxy]phenyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(c2ccc(OCc3cc(N4CCCC4)nc4ccccc34)c(F)c2)C[C@@H]1C(=O)NO |
| InChI | InChI=1S/C26H26FN3O5/c1-34-25(32)26(14-19(26)24(31)29-33)17-8-9-22(20(27)13-17)35-15-16-12-23(30-10-4-5-11-30)28-21-7-3-2-6-18(16)21/h2-3,6-9,12-13,19,33H,4-5,10-11,14-15H2,1H3,(H,29,31)/t19-,26-/m1/s1 |
| InChIKey | IDNYXAHUUPKJCG-NIYFSFCBSA-N |
| XLogP | 3.49 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|