C24H22FN3O4 — CID 10151290
trans-(1S,2S)-1-[4-[(2-cyclopropylquinolin-4-yl)methoxy]-3-fluorophenyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide (PubChem CID 10151290) has the molecular formula C24H22FN3O4 and a molecular weight of 435.46 g/mol. Its IUPAC name is trans-(1S,2S)-1-[4-[(2-cyclopropylquinolin-4-yl)methoxy]-3-fluorophenyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide.
| Compound Name | trans-(1S,2S)-1-[4-[(2-cyclopropylquinolin-4-yl)methoxy]-3-fluorophenyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 10151290 |
| Molecular Formula | C24H22FN3O4 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | trans-(1S,2S)-1-[4-[(2-cyclopropylquinolin-4-yl)methoxy]-3-fluorophenyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
| SMILES | NC(=O)[C@@]1(c2ccc(OCc3cc(C4CC4)nc4ccccc34)c(F)c2)C[C@@H]1C(=O)NO |
| InChI | InChI=1S/C24H22FN3O4/c25-18-10-15(24(23(26)30)11-17(24)22(29)28-31)7-8-21(18)32-12-14-9-20(13-5-6-13)27-19-4-2-1-3-16(14)19/h1-4,7-10,13,17,31H,5-6,11-12H2,(H2,26,30)(H,28,29)/t17-,24-/m1/s1 |
| InChIKey | FULSASNNEAUPBS-MZNJEOGPSA-N |
| XLogP | 3.08 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|