C28H24FN3O5 — CID 20748744
methyl 1-[[3-fluoro-4-[(2-pyridin-4-ylquinolin-4-yl)methoxy]phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate (PubChem CID 20748744) has the molecular formula C28H24FN3O5 and a molecular weight of 501.51 g/mol. Its IUPAC name is methyl 1-[[3-fluoro-4-[(2-pyridin-4-ylquinolin-4-yl)methoxy]phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[[3-fluoro-4-[(2-pyridin-4-ylquinolin-4-yl)methoxy]phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 20748744 |
| Molecular Formula | C28H24FN3O5 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | methyl 1-[[3-fluoro-4-[(2-pyridin-4-ylquinolin-4-yl)methoxy]phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(Cc2ccc(OCc3cc(-c4ccncc4)nc4ccccc34)c(F)c2)CC1C(=O)NO |
| InChI | InChI=1S/C28H24FN3O5/c1-36-27(34)28(15-21(28)26(33)32-35)14-17-6-7-25(22(29)12-17)37-16-19-13-24(18-8-10-30-11-9-18)31-23-5-3-2-4-20(19)23/h2-13,21,35H,14-16H2,1H3,(H,32,33) |
| InChIKey | FZEMAIXDZDRNSX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|