C29H27N3O5 — CID 44581112
cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-[(2-pyridin-3-ylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxylate (PubChem CID 44581112) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-[(2-pyridin-3-ylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-[(2-pyridin-3-ylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 44581112 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-[(2-pyridin-3-ylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccc(OCc3cc(-c4cccnc4)nc4ccccc34)cc2)C[C@@H]1C(=O)NO |
| InChI | InChI=1S/C29H27N3O5/c1-2-36-28(34)29(16-24(29)27(33)32-35)15-19-9-11-22(12-10-19)37-18-21-14-26(20-6-5-13-30-17-20)31-25-8-4-3-7-23(21)25/h3-14,17,24,35H,2,15-16,18H2,1H3,(H,32,33)/t24-,29+/m1/s1 |
| InChIKey | BDVFOWBSUKDWDA-GIGWZHCTSA-N |
| XLogP | 4.49 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|