C23H23FN4O4 — CID 20748487
1-[[3-fluoro-4-[[2-(methylamino)quinolin-4-yl]methoxy]phenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide (PubChem CID 20748487) has the molecular formula C23H23FN4O4 and a molecular weight of 438.46 g/mol. Its IUPAC name is 1-[[3-fluoro-4-[[2-(methylamino)quinolin-4-yl]methoxy]phenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide.
| Compound Name | 1-[[3-fluoro-4-[[2-(methylamino)quinolin-4-yl]methoxy]phenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 20748487 |
| Molecular Formula | C23H23FN4O4 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-[[3-fluoro-4-[[2-(methylamino)quinolin-4-yl]methoxy]phenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
| SMILES | CNc1cc(COc2ccc(CC3(C(N)=O)CC3C(=O)NO)cc2F)c2ccccc2n1 |
| InChI | InChI=1S/C23H23FN4O4/c1-26-20-9-14(15-4-2-3-5-18(15)27-20)12-32-19-7-6-13(8-17(19)24)10-23(22(25)30)11-16(23)21(29)28-31/h2-9,16,31H,10-12H2,1H3,(H2,25,30)(H,26,27)(H,28,29) |
| InChIKey | QMSQXOQMJJNFQO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|