C37H41N3O4 — CID 142258685
trans-(1S,2S)-N-hydroxy-2-[(E)-3-[methyl(3-methylpentyl)amino]-3-oxoprop-1-enyl]-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxamide (PubChem CID 142258685) has the molecular formula C37H41N3O4 and a molecular weight of 591.75 g/mol. Its IUPAC name is trans-(1S,2S)-N-hydroxy-2-[(E)-3-[methyl(3-methylpentyl)amino]-3-oxoprop-1-enyl]-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-hydroxy-2-[(E)-3-[methyl(3-methylpentyl)amino]-3-oxoprop-1-enyl]-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142258685 |
| Molecular Formula | C37H41N3O4 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | trans-(1S,2S)-N-hydroxy-2-[(E)-3-[methyl(3-methylpentyl)amino]-3-oxoprop-1-enyl]-2-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxamide |
| SMILES | CCC(C)CCN(C)C(=O)/C=C/[C@@]1(Cc2ccc(OCc3cc(-c4ccccc4)nc4ccccc34)cc2)C[C@@H]1C(=O)NO |
| InChI | InChI=1S/C37H41N3O4/c1-4-26(2)19-21-40(3)35(41)18-20-37(24-32(37)36(42)39-43)23-27-14-16-30(17-15-27)44-25-29-22-34(28-10-6-5-7-11-28)38-33-13-9-8-12-31(29)33/h5-18,20,22,26,32,43H,4,19,21,23-25H2,1-3H3,(H,39,42)/b20-18+/t26?,32-,37-/m1/s1 |
| InChIKey | KSFUPDGDAJUYOO-KDZQMOLCSA-N |
| XLogP | 6.99 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|