C28H33N3O4 — CID 142258853
2-[[4-[(2-ethylquinolin-4-yl)methoxy]phenyl]methyl]-N-hydroxycyclopropane-1-carboxamide;pyrrolidine-1-carbaldehyde (PubChem CID 142258853) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-[[4-[(2-ethylquinolin-4-yl)methoxy]phenyl]methyl]-N-hydroxycyclopropane-1-carboxamide;pyrrolidine-1-carbaldehyde.
| Compound Name | 2-[[4-[(2-ethylquinolin-4-yl)methoxy]phenyl]methyl]-N-hydroxycyclopropane-1-carboxamide;pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 142258853 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-[[4-[(2-ethylquinolin-4-yl)methoxy]phenyl]methyl]-N-hydroxycyclopropane-1-carboxamide;pyrrolidine-1-carbaldehyde |
| SMILES | CCc1cc(COc2ccc(CC3CC3C(=O)NO)cc2)c2ccccc2n1.O=CN1CCCC1 |
| InChI | InChI=1S/C23H24N2O3.C5H9NO/c1-2-18-12-17(20-5-3-4-6-22(20)24-18)14-28-19-9-7-15(8-10-19)11-16-13-21(16)23(26)25-27;7-5-6-3-1-2-4-6/h3-10,12,16,21,27H,2,11,13-14H2,1H3,(H,25,26);5H,1-4H2 |
| InChIKey | PBOHZNZSNLCQCA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|