C25H26N4O6 — CID 87976885
(3R,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylic acid (PubChem CID 87976885) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is (3R,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylic acid.
| Compound Name | (3R,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87976885 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (3R,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylic acid |
| SMILES | Cc1cc(COc2ccc(NC(=O)[C@H]3CCN(C(=O)O)C[C@@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C25H26N4O6/c1-15-12-16(19-4-2-3-5-22(19)26-15)14-35-18-8-6-17(7-9-18)27-23(30)20-10-11-29(25(32)33)13-21(20)24(31)28-34/h2-9,12,20-21,34H,10-11,13-14H2,1H3,(H,27,30)(H,28,31)(H,32,33)/t20-,21-/m0/s1 |
| InChIKey | UYNZWMHLQYGAJI-SFTDATJTSA-N |
| XLogP | 3.18 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|