C29H28N4O5S — CID 87907252
(3S,4S)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 87907252) has the molecular formula C29H28N4O5S and a molecular weight of 544.63 g/mol. Its IUPAC name is (3S,4S)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | (3S,4S)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 87907252 |
| Molecular Formula | C29H28N4O5S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | (3S,4S)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(COc2ccc(C(=O)N[C@@H]3CN(C(=O)c4cccs4)CC[C@@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C29H28N4O5S/c1-18-15-20(22-5-2-3-6-24(22)30-18)17-38-21-10-8-19(9-11-21)27(34)31-25-16-33(13-12-23(25)28(35)32-37)29(36)26-7-4-14-39-26/h2-11,14-15,23,25,37H,12-13,16-17H2,1H3,(H,31,34)(H,32,35)/t23-,25+/m0/s1 |
| InChIKey | SPERGQJTKGZKNM-UKILVPOCSA-N |
| XLogP | 3.95 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|