C33H34N4O4 — CID 90944491
(3S,4S)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-(3-phenylprop-2-enyl)piperidine-4-carboxamide (PubChem CID 90944491) has the molecular formula C33H34N4O4 and a molecular weight of 550.66 g/mol. Its IUPAC name is (3S,4S)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-(3-phenylprop-2-enyl)piperidine-4-carboxamide.
| Compound Name | (3S,4S)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-(3-phenylprop-2-enyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90944491 |
| Molecular Formula | C33H34N4O4 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | (3S,4S)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-1-(3-phenylprop-2-enyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(COc2ccc(C(=O)N[C@@H]3CN(CC=Cc4ccccc4)CC[C@@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C33H34N4O4/c1-23-20-26(28-11-5-6-12-30(28)34-23)22-41-27-15-13-25(14-16-27)32(38)35-31-21-37(19-17-29(31)33(39)36-40)18-7-10-24-8-3-2-4-9-24/h2-16,20,29,31,40H,17-19,21-22H2,1H3,(H,35,38)(H,36,39)/t29-,31+/m0/s1 |
| InChIKey | ZMDYCXZRZBEJRK-IGYGKHONSA-N |
| XLogP | 4.76 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|