C28H27N3O4 — CID 22258460
N-[2-(hydroxycarbamoyl)cyclopentyl]-6-[(2-methylquinolin-4-yl)methoxy]naphthalene-2-carboxamide (PubChem CID 22258460) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[2-(hydroxycarbamoyl)cyclopentyl]-6-[(2-methylquinolin-4-yl)methoxy]naphthalene-2-carboxamide.
| Compound Name | N-[2-(hydroxycarbamoyl)cyclopentyl]-6-[(2-methylquinolin-4-yl)methoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 22258460 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[2-(hydroxycarbamoyl)cyclopentyl]-6-[(2-methylquinolin-4-yl)methoxy]naphthalene-2-carboxamide |
| SMILES | Cc1cc(COc2ccc3cc(C(=O)NC4CCCC4C(=O)NO)ccc3c2)c2ccccc2n1 |
| InChI | InChI=1S/C28H27N3O4/c1-17-13-21(23-5-2-3-7-25(23)29-17)16-35-22-12-11-18-14-20(10-9-19(18)15-22)27(32)30-26-8-4-6-24(26)28(33)31-34/h2-3,5,7,9-15,24,26,34H,4,6,8,16H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | LKNXEIPOJCHXGY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|