C26H31N3O2 — CID 20729957
N-[2-methyl-6-(methylamino)cyclohexyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 20729957) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[2-methyl-6-(methylamino)cyclohexyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | N-[2-methyl-6-(methylamino)cyclohexyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 20729957 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[2-methyl-6-(methylamino)cyclohexyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | CNC1CCCC(C)C1NC(=O)c1ccc(OCc2cc(C)nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H31N3O2/c1-17-7-6-10-24(27-3)25(17)29-26(30)19-11-13-21(14-12-19)31-16-20-15-18(2)28-23-9-5-4-8-22(20)23/h4-5,8-9,11-15,17,24-25,27H,6-7,10,16H2,1-3H3,(H,29,30) |
| InChIKey | WLTDLGICYSJFNQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |