C36H42F6N4O10 — CID 20729890
tert-butyl 2-[(3S,4S)-4-(hydroxycarbamoyl)-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidin-1-yl]-2-methylpropanoate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 20729890) has the molecular formula C36H42F6N4O10 and a molecular weight of 804.74 g/mol. Its IUPAC name is tert-butyl 2-[(3S,4S)-4-(hydroxycarbamoyl)-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidin-1-yl]-2-methylpropanoate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | tert-butyl 2-[(3S,4S)-4-(hydroxycarbamoyl)-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidin-1-yl]-2-methylpropanoate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 20729890 |
| Molecular Formula | C36H42F6N4O10 |
| Molecular Weight | 804.74 g/mol |
| Exact Mass | 804.28 |
| IUPAC Name | tert-butyl 2-[(3S,4S)-4-(hydroxycarbamoyl)-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidin-1-yl]-2-methylpropanoate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cc(COc2ccc(C(=O)N[C@@H]3CN(C(C)(C)C(=O)OC(C)(C)C)CC[C@@H]3C(=O)NO)cc2)c2ccccc2n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C32H40N4O6.2C2HF3O2/c1-20-17-22(24-9-7-8-10-26(24)33-20)19-41-23-13-11-21(12-14-23)28(37)34-27-18-36(16-15-25(27)29(38)35-40)32(5,6)30(39)42-31(2,3)4;2*3-2(4,5)1(6)7/h7-14,17,25,27,40H,15-16,18-19H2,1-6H3,(H,34,37)(H,35,38);2*(H,6,7)/t25-,27+;;/m0../s1 |
| InChIKey | JGLHPTOMXIIFMK-MDNXBZKESA-N |
| XLogP | 5.43 |
| TPSA | 204.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.74 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|