C30H30F8N4O8 — CID 87907178
(3S,4S)-1-(2,2-difluoroethyl)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87907178) has the molecular formula C30H30F8N4O8 and a molecular weight of 726.57 g/mol. Its IUPAC name is (3S,4S)-1-(2,2-difluoroethyl)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3S,4S)-1-(2,2-difluoroethyl)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87907178 |
| Molecular Formula | C30H30F8N4O8 |
| Molecular Weight | 726.57 g/mol |
| Exact Mass | 726.19 |
| IUPAC Name | (3S,4S)-1-(2,2-difluoroethyl)-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cc(COc2ccc(C(=O)N[C@@H]3CN(CC(F)F)CC[C@@H]3C(=O)NO)cc2)c2ccccc2n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H28F2N4O4.2C2HF3O2/c1-16-12-18(20-4-2-3-5-22(20)29-16)15-36-19-8-6-17(7-9-19)25(33)30-23-13-32(14-24(27)28)11-10-21(23)26(34)31-35;2*3-2(4,5)1(6)7/h2-9,12,21,23-24,35H,10-11,13-15H2,1H3,(H,30,33)(H,31,34);2*(H,6,7)/t21-,23+;;/m0../s1 |
| InChIKey | PWRALBCXYKONMB-WEYMJNKBSA-N |
| XLogP | 4.58 |
| TPSA | 178.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|