C30H32F6N4O9 — CID 87907467
(3S,4S)-N-hydroxy-1-(2-hydroxyethyl)-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87907467) has the molecular formula C30H32F6N4O9 and a molecular weight of 706.59 g/mol. Its IUPAC name is (3S,4S)-N-hydroxy-1-(2-hydroxyethyl)-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3S,4S)-N-hydroxy-1-(2-hydroxyethyl)-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87907467 |
| Molecular Formula | C30H32F6N4O9 |
| Molecular Weight | 706.59 g/mol |
| Exact Mass | 706.21 |
| IUPAC Name | (3S,4S)-N-hydroxy-1-(2-hydroxyethyl)-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cc(COc2ccc(C(=O)N[C@@H]3CN(CCO)CC[C@@H]3C(=O)NO)cc2)c2ccccc2n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H30N4O5.2C2HF3O2/c1-17-14-19(21-4-2-3-5-23(21)27-17)16-35-20-8-6-18(7-9-20)25(32)28-24-15-30(12-13-31)11-10-22(24)26(33)29-34;2*3-2(4,5)1(6)7/h2-9,14,22,24,31,34H,10-13,15-16H2,1H3,(H,28,32)(H,29,33);2*(H,6,7)/t22-,24+;;/m0../s1 |
| InChIKey | UCAMOTPOTLTJPW-PRMRSNQMSA-N |
| XLogP | 3.31 |
| TPSA | 198.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|