C28H32N4O4 — CID 87977443
(2R,3R)-1-(cyclopropylmethyl)-3-N-hydroxy-2-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]piperidine-2,3-dicarboxamide (PubChem CID 87977443) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is (2R,3R)-1-(cyclopropylmethyl)-3-N-hydroxy-2-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]piperidine-2,3-dicarboxamide.
| Compound Name | (2R,3R)-1-(cyclopropylmethyl)-3-N-hydroxy-2-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]piperidine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 87977443 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (2R,3R)-1-(cyclopropylmethyl)-3-N-hydroxy-2-N-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]piperidine-2,3-dicarboxamide |
| SMILES | Cc1cc(COc2ccc(NC(=O)[C@H]3[C@H](C(=O)NO)CCCN3CC3CC3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C28H32N4O4/c1-18-15-20(23-5-2-3-7-25(23)29-18)17-36-22-12-10-21(11-13-22)30-28(34)26-24(27(33)31-35)6-4-14-32(26)16-19-8-9-19/h2-3,5,7,10-13,15,19,24,26,35H,4,6,8-9,14,16-17H2,1H3,(H,30,34)(H,31,33)/t24-,26-/m1/s1 |
| InChIKey | XORDSICOUVZNCB-AOYPEHQESA-N |
| XLogP | 4.06 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|