C26H27N3O4 — CID 87928243
cis-(1R,2S)-N-hydroxy-2-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]cyclopentane-1-carboxamide (PubChem CID 87928243) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is cis-(1R,2S)-N-hydroxy-2-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]cyclopentane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-hydroxy-2-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 87928243 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | cis-(1R,2S)-N-hydroxy-2-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]cyclopentane-1-carboxamide |
| SMILES | Cc1cc(COc2ccc(C3=NOC([C@H]4CCC[C@H]4C(=O)NO)C3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C26H27N3O4/c1-16-13-18(20-5-2-3-8-23(20)27-16)15-32-19-11-9-17(10-12-19)24-14-25(33-29-24)21-6-4-7-22(21)26(30)28-31/h2-3,5,8-13,21-22,25,31H,4,6-7,14-15H2,1H3,(H,28,30)/t21-,22+,25?/m0/s1 |
| InChIKey | NYKUGCJOSYKNLA-FQTTXOOSSA-N |
| XLogP | 4.54 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|