C26H28N4O4 — CID 10479371
N-hydroxy-2-[3-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]pyrrolidin-3-yl]acetamide (PubChem CID 10479371) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is N-hydroxy-2-[3-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-hydroxy-2-[3-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 10479371 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | N-hydroxy-2-[3-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]pyrrolidin-3-yl]acetamide |
| SMILES | Cc1cc(COc2ccc(C3=NOC(C4(CC(=O)NO)CCNC4)C3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C26H28N4O4/c1-17-12-19(21-4-2-3-5-22(21)28-17)15-33-20-8-6-18(7-9-20)23-13-24(34-30-23)26(10-11-27-16-26)14-25(31)29-32/h2-9,12,24,27,32H,10-11,13-16H2,1H3,(H,29,31) |
| InChIKey | YHHVXSZMUIKRNJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|