C24H27N5O4 — CID 18379278
N-[4-[2-(hydroxyamino)-2-oxoethyl]piperidin-4-yl]-6-[(2-methylquinolin-4-yl)methoxy]pyridine-3-carboxamide (PubChem CID 18379278) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[4-[2-(hydroxyamino)-2-oxoethyl]piperidin-4-yl]-6-[(2-methylquinolin-4-yl)methoxy]pyridine-3-carboxamide.
| Compound Name | N-[4-[2-(hydroxyamino)-2-oxoethyl]piperidin-4-yl]-6-[(2-methylquinolin-4-yl)methoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 18379278 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[4-[2-(hydroxyamino)-2-oxoethyl]piperidin-4-yl]-6-[(2-methylquinolin-4-yl)methoxy]pyridine-3-carboxamide |
| SMILES | Cc1cc(COc2ccc(C(=O)NC3(CC(=O)NO)CCNCC3)cn2)c2ccccc2n1 |
| InChI | InChI=1S/C24H27N5O4/c1-16-12-18(19-4-2-3-5-20(19)27-16)15-33-22-7-6-17(14-26-22)23(31)28-24(13-21(30)29-32)8-10-25-11-9-24/h2-7,12,14,25,32H,8-11,13,15H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | HEQPPLOYNUFRMV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|