C28H32N4O5 — CID 142087428
N-[4-acetamido-1-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]-2-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 142087428) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-[4-acetamido-1-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]-2-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | N-[4-acetamido-1-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]-2-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 142087428 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | N-[4-acetamido-1-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]-2-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | CC(=O)NC1CCC(CC(=O)NO)(NC(=O)c2ccccc2OCc2cc(C)nc3ccccc23)CC1 |
| InChI | InChI=1S/C28H32N4O5/c1-18-15-20(22-7-3-5-9-24(22)29-18)17-37-25-10-6-4-8-23(25)27(35)31-28(16-26(34)32-36)13-11-21(12-14-28)30-19(2)33/h3-10,15,21,36H,11-14,16-17H2,1-2H3,(H,30,33)(H,31,35)(H,32,34) |
| InChIKey | PDJGUOVUKFVZHZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|