C32H32N4O5 — CID 142087400
N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-(2-phenylacetyl)pyrrolidin-3-yl]-2-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 142087400) has the molecular formula C32H32N4O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-(2-phenylacetyl)pyrrolidin-3-yl]-2-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-(2-phenylacetyl)pyrrolidin-3-yl]-2-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 142087400 |
| Molecular Formula | C32H32N4O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-(2-phenylacetyl)pyrrolidin-3-yl]-2-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | Cc1cc(COc2ccccc2C(=O)NC2(CC(=O)NO)CCN(C(=O)Cc3ccccc3)C2)c2ccccc2n1 |
| InChI | InChI=1S/C32H32N4O5/c1-22-17-24(25-11-5-7-13-27(25)33-22)20-41-28-14-8-6-12-26(28)31(39)34-32(19-29(37)35-40)15-16-36(21-32)30(38)18-23-9-3-2-4-10-23/h2-14,17,40H,15-16,18-21H2,1H3,(H,34,39)(H,35,37) |
| InChIKey | WGKOXINSWBSMBL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|