C24H24N4O6 — CID 91598469
N-hydroxy-4-[3-(hydroxyamino)-3-oxopropyl]-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 91598469) has the molecular formula C24H24N4O6 and a molecular weight of 464.48 g/mol. Its IUPAC name is N-hydroxy-4-[3-(hydroxyamino)-3-oxopropyl]-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-hydroxy-4-[3-(hydroxyamino)-3-oxopropyl]-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 91598469 |
| Molecular Formula | C24H24N4O6 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-hydroxy-4-[3-(hydroxyamino)-3-oxopropyl]-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(COc2ccc(C3=C(CCC(=O)NO)C(C(=O)NO)ON3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C24H24N4O6/c1-14-12-16(18-4-2-3-5-20(18)25-14)13-33-17-8-6-15(7-9-17)22-19(10-11-21(29)26-31)23(34-28-22)24(30)27-32/h2-9,12,23,28,31-32H,10-11,13H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | OMBBLSGIFSRAFZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|