C28H28N4O5 — CID 90787584
3-(furan-2-ylmethylamino)-N-hydroxy-3-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,5-dihydro-1,2-oxazol-5-yl]propanamide (PubChem CID 90787584) has the molecular formula C28H28N4O5 and a molecular weight of 500.56 g/mol. Its IUPAC name is 3-(furan-2-ylmethylamino)-N-hydroxy-3-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,5-dihydro-1,2-oxazol-5-yl]propanamide.
| Compound Name | 3-(furan-2-ylmethylamino)-N-hydroxy-3-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,5-dihydro-1,2-oxazol-5-yl]propanamide |
|---|---|
| PubChem CID | 90787584 |
| Molecular Formula | C28H28N4O5 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 3-(furan-2-ylmethylamino)-N-hydroxy-3-[3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,5-dihydro-1,2-oxazol-5-yl]propanamide |
| SMILES | Cc1cc(COc2ccc(C3=CC(C(CC(=O)NO)NCc4ccco4)ON3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C28H28N4O5/c1-18-13-20(23-6-2-3-7-24(23)30-18)17-36-21-10-8-19(9-11-21)25-14-27(37-32-25)26(15-28(33)31-34)29-16-22-5-4-12-35-22/h2-14,26-27,29,32,34H,15-17H2,1H3,(H,31,33) |
| InChIKey | PKTYQSKORWBOGW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|