C27H31N5O4 — CID 91040055
N-hydroxy-2-[3-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-piperazin-2-ylmethyl]-2,5-dihydro-1,2-oxazol-5-yl]acetamide (PubChem CID 91040055) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-hydroxy-2-[3-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-piperazin-2-ylmethyl]-2,5-dihydro-1,2-oxazol-5-yl]acetamide.
| Compound Name | N-hydroxy-2-[3-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-piperazin-2-ylmethyl]-2,5-dihydro-1,2-oxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 91040055 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | N-hydroxy-2-[3-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-piperazin-2-ylmethyl]-2,5-dihydro-1,2-oxazol-5-yl]acetamide |
| SMILES | Cc1cc(COc2ccc(C(C3=CC(CC(=O)NO)ON3)C3CNCCN3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C27H31N5O4/c1-17-12-19(22-4-2-3-5-23(22)30-17)16-35-20-8-6-18(7-9-20)27(25-15-28-10-11-29-25)24-13-21(36-32-24)14-26(33)31-34/h2-9,12-13,21,25,27-29,32,34H,10-11,14-16H2,1H3,(H,31,33) |
| InChIKey | ZUPWIDLPLNJRIK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|